CAS 36914-69-9 appears in our catalog under these names: 1-Phenyl-2-pyrazin-2-ylethanol, 95%, 1-Phenyl-2-pyrazin-2-yl ethanol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-phenyl-2-pyrazin-2-ylethanol (CAS 36914-69-9) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-phenyl-2-pyrazin-2-ylethanol. InChIKey: GCLRAFFYSKHBNT-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-phenyl-2-pyrazin-2-ylethanol |
| InChIKey | GCLRAFFYSKHBNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=NC=CN=C2)O |
Computed by PubChem (NCBI)