cas: 215794-11-9 — see every product listed under this CAS number, including other names
1-(5-bromo-3,4-dihydro-2(1H)-isoquinolinyl)-2,2,2-trifluoro-Ethanone, 99%, 99% (CAS 215794-11-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I57P-500mg |
| cas | 215794-11-9 |
| size | 500mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 1322.00 Pln | |
| Chemat | 1g | 1864.40 Pln | |
| Chemat | 5g | 6544.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (CAS 215794-11-9) is a chemical compound with the molecular formula C11H9BrF3NO and a molecular weight of 308.09 g/mol. IUPAC name: 1-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone. InChIKey: YCUBYMZVELORFT-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO |
|---|---|
| Molecular weight | 308.09 g/mol |
| IUPAC name | 1-(5-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | YCUBYMZVELORFT-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=CC=C2)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)