CAS 69949-67-3 appears in our catalog under these names: 3-Bromo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one, 95%, 3-Bromo-1-(3-(trifluoromethyl)phenyl)pyrrolidin-2-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
3-bromo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (CAS 69949-67-3) is a chemical compound with the molecular formula C11H9BrF3NO and a molecular weight of 308.09 g/mol. IUPAC name: 3-bromo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one. InChIKey: FBWCCKYAGCRWTI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO |
|---|---|
| Molecular weight | 308.09 g/mol |
| IUPAC name | 3-bromo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| InChIKey | FBWCCKYAGCRWTI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)