CAS 181514-35-2 appears in our catalog under these names: 1-(7-Bromo-3,4-dihydroisoquinolin-2(1h)-yl)-2,2,2-trifluoroethanone, 95%, 1-(7-Bromo-3,4-dihydro-2(1H)-isoquinolinyl)-2,2,2-trifluoroethanone, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (CAS 181514-35-2) is a chemical compound with the molecular formula C11H9BrF3NO and a molecular weight of 308.09 g/mol. IUPAC name: 1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone. InChIKey: VKQVUQYZTXGZLW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO |
|---|---|
| Molecular weight | 308.09 g/mol |
| IUPAC name | 1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | VKQVUQYZTXGZLW-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C=CC(=C2)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)