CAS 944904-58-9 appears in our catalog under these names: 1–(6–(Trifluoromethyl)pyridin–2–yl)ethanone, 1-[6-(Trifluoromethyl)-2-pyridinyl]ethanone, 97%, 97%, 1-(6-(Trifluoromethyl)pyridin-2-yl)ethanone, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[6-(trifluoromethyl)-2-pyridinyl]ethanone (CAS 944904-58-9) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: 1-[6-(trifluoromethyl)-2-pyridinyl]ethanone. InChIKey: ROKPMZALLPKDMB-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | 1-[6-(trifluoromethyl)-2-pyridinyl]ethanone |
| InChIKey | ROKPMZALLPKDMB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)