CAS 74467-00-8 is the registry number for 2-(Trifluoromethyl)benzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
(NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine (CAS 74467-00-8) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: (NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine. InChIKey: GBZLIAANNYDSOB-LFYBBSHMSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | (NE)-N-[[2-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
| InChIKey | GBZLIAANNYDSOB-LFYBBSHMSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/O)C(F)(F)F |
Computed by PubChem (NCBI)