CAS 1060801-56-0 appears in our catalog under these names: 2,2,2-Trifluoro-1-(5-methylpyridin-2-yl)ethanone, 95%, 2,2,2–Trifluoro–1–(5–methylpyridin–2–yl)ethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2,2,2-trifluoro-1-(5-methyl-2-pyridinyl)ethanone (CAS 1060801-56-0) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: 2,2,2-trifluoro-1-(5-methyl-2-pyridinyl)ethanone. InChIKey: XXWGGGAVTBJXKX-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(5-methyl-2-pyridinyl)ethanone |
| InChIKey | XXWGGGAVTBJXKX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)