cas: 1060811-01-9 — see every product listed under this CAS number, including other names
1-(6-(Trifluoromethyl)pyridin-3-yl)cyclopropane-1-carboxylic acid, 97% (CAS 1060811-01-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1225088-5g |
| cas | 1060811-01-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 36291.64 Pln | |
| Fluorochem | 100mg | 2044.09 Pln | |
| Fluorochem | 250mg | 3236.38 Pln | |
| Fluorochem | 500mg | 5339.80 Pln | |
| Fluorochem | 1g | 7948.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[6-(trifluoromethyl)-3-pyridinyl]cyclopropane-1-carboxylic acid (CAS 1060811-01-9) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-[6-(trifluoromethyl)-3-pyridinyl]cyclopropane-1-carboxylic acid. InChIKey: AUGIDCOYKPCYOG-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 1-[6-(trifluoromethyl)-3-pyridinyl]cyclopropane-1-carboxylic acid |
| InChIKey | AUGIDCOYKPCYOG-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CN=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)