cas: 33627-02-0 — see every product listed under this CAS number, including other names
1-(6-Fluoronaphthalen-2-yl)ethanone 97% (CAS 33627-02-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A879297-50mg |
| cas | 33627-02-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 720.81 Pln | |
| Ambeed | 100mg | 1004.50 Pln | |
| Ambeed | 250mg | 1838.88 Pln | |
| Ambeed | 1g | 4631.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A879297 |
1-(6-fluoronaphthalen-2-yl)ethanone (CAS 33627-02-0) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 1-(6-fluoronaphthalen-2-yl)ethanone. InChIKey: TXXWLEREQYRORU-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 1-(6-fluoronaphthalen-2-yl)ethanone |
| InChIKey | TXXWLEREQYRORU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)F |
Computed by PubChem (NCBI)