cas: 33627-02-0 — see every product listed under this CAS number, including other names
1-(6-Fluoronaphthalen-2-yl)ethanone, 97% (CAS 33627-02-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546946-50MG |
| cas | 33627-02-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 706.02 Pln | |
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 1g | 4642.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(6-fluoronaphthalen-2-yl)ethanone (CAS 33627-02-0) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 1-(6-fluoronaphthalen-2-yl)ethanone. InChIKey: TXXWLEREQYRORU-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 1-(6-fluoronaphthalen-2-yl)ethanone |
| InChIKey | TXXWLEREQYRORU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)F |
Computed by PubChem (NCBI)