Products 324-94-7
CAS 324-94-7 appears in our catalog under these names: 4–Fluoro–4'–hydroxybiphenyl, 4-Fluoro-4'-hydroxybiphenyl, >98.0%(GC), 4'-Fluoro-[1,1'-biphenyl]-4-ol 98%, 4'-Fluoro-[1,1'-biphenyl]-4-ol, 98%, 98%, 4'-Fluoro[1,1'-biphenyl]-4-ol, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 250mg, 1g, 500g.
4-(4-fluorophenyl)phenol (CAS 324-94-7) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 4-(4-fluorophenyl)phenol. InChIKey: QSJNKJGPJVOGPK-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 4-(4-fluorophenyl)phenol |
| InChIKey | QSJNKJGPJVOGPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-4'-hydroxybiphenyl, 4'-Fluoro-[1,1'-biphenyl]-4-ol, 4-(4-Fluorophenyl)phenol, 4-Hydroxy-4'-fluorobiphenyl, 4'-Fluoro-biphenyl-4-ol, 4'-fluoro[1,1'-biphenyl]-4-ol, 4'-Fluorobiphenyl-1-ol, 4'-Fluoro-[1,1'-biphenyl]-4-ol;4-Fluoro-4'-hydroxybiphenyl, 4'-fluorobiphenyl-4-ol, 4'-fluoro-4-hydroxybiphenyl