cas: 2700-47-2 — see every product listed under this CAS number, including other names
1-(6-Methoxynaphthalen-2-yl)propan-1-one, 95% (CAS 2700-47-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339950-25G |
| cas | 2700-47-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 596.68 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(6-methoxynaphthalen-2-yl)propan-1-one (CAS 2700-47-2) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)propan-1-one. InChIKey: LWOTXBQKJLOAOZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-(6-methoxynaphthalen-2-yl)propan-1-one |
| InChIKey | LWOTXBQKJLOAOZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)