CAS 187344-44-1 is the registry number for [1,1'-Biphenyl]-2,4'-diyldimethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[2-(hydroxymethyl)phenyl]phenyl]methanol (CAS 187344-44-1) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: [4-[2-(hydroxymethyl)phenyl]phenyl]methanol. InChIKey: QEYKYHBKQHGNPQ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | [4-[2-(hydroxymethyl)phenyl]phenyl]methanol |
| InChIKey | QEYKYHBKQHGNPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)