CAS 2700-47-2 appears in our catalog under these names: 6'-Methoxy-2'-propiononaphthone, 98%, 6²-Methoxy-2²-propiononaphthone, 1-(6-Methoxynaphthalen-2-yl)propan-1-one, 97%, 97%, 1-(6-Methoxynaphthalen-2-yl)propan-1-one, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 0,25g, 2,5g, 50g, 10g.
1-(6-methoxynaphthalen-2-yl)propan-1-one (CAS 2700-47-2) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)propan-1-one. InChIKey: LWOTXBQKJLOAOZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-(6-methoxynaphthalen-2-yl)propan-1-one |
| InChIKey | LWOTXBQKJLOAOZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)