cas: 181514-35-2 — see every product listed under this CAS number, including other names
1-(7-Bromo-3,4-dihydro-2(1H)-isoquinolinyl)-2,2,2-trifluoroethanone, 97%, 97% (CAS 181514-35-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133Y4-100mg |
| cas | 181514-35-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone (CAS 181514-35-2) is a chemical compound with the molecular formula C11H9BrF3NO and a molecular weight of 308.09 g/mol. IUPAC name: 1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone. InChIKey: VKQVUQYZTXGZLW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrF3NO |
|---|---|
| Molecular weight | 308.09 g/mol |
| IUPAC name | 1-(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | VKQVUQYZTXGZLW-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C=CC(=C2)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)