cas: 383868-64-2 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-4-bromo-2-nitrobenzene, 97%, 97% (CAS 383868-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CPOE-250mg |
| cas | 383868-64-2 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Chemat | 10g | 2027.60 Pln | |
| Chemat | 25g | 3942.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-nitro-1-phenylmethoxybenzene (CAS 383868-64-2) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 4-bromo-2-nitro-1-phenylmethoxybenzene. InChIKey: HUELJXGNXNSEQJ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 4-bromo-2-nitro-1-phenylmethoxybenzene |
| InChIKey | HUELJXGNXNSEQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)