CAS 313372-74-6 appears in our catalog under these names: N-(4-Acetylphenyl)-5-bromo-2-furamide, 95%, N-(4-Acetylphenyl)-5-bromofuran-2-carboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(4-acetylphenyl)-5-bromofuran-2-carboxamide (CAS 313372-74-6) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: N-(4-acetylphenyl)-5-bromofuran-2-carboxamide. InChIKey: SUAJRSJQVUOCRV-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | N-(4-acetylphenyl)-5-bromofuran-2-carboxamide |
| InChIKey | SUAJRSJQVUOCRV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)