CAS 4514-28-7 appears in our catalog under these names: 4-(Benzyloxy)-1-bromo-2-nitrobenzene, 95%, 4–(benzyloxy)–1–bromo–2–nitrobenzene, 4-(Benzyloxy)-1-bromo-2-nitrobenzene 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1-bromo-2-nitro-4-phenylmethoxybenzene (CAS 4514-28-7) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 1-bromo-2-nitro-4-phenylmethoxybenzene. InChIKey: BPSNHIPXNKPDPA-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 1-bromo-2-nitro-4-phenylmethoxybenzene |
| InChIKey | BPSNHIPXNKPDPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)