cas: 15862-94-9 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-4,5-dimethoxy-2-nitrobenzene 95% (CAS 15862-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A989129-100mg |
| cas | 15862-94-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A989129 |
1-(chloromethyl)-4,5-dimethoxy-2-nitrobenzene (CAS 15862-94-9) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 1-(chloromethyl)-4,5-dimethoxy-2-nitrobenzene. InChIKey: VRHNUGLFVZJARZ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 1-(chloromethyl)-4,5-dimethoxy-2-nitrobenzene |
| InChIKey | VRHNUGLFVZJARZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CCl)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)