cas: 1612172-62-9 — see every product listed under this CAS number, including other names
1-(Cyclopropanesulfonyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole 98% (CAS 1612172-62-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A991886-100mg |
| cas | 1612172-62-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1249.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A991886 |
1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1612172-62-9) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: 1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: CWOOICDCNKJNSS-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | 1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | CWOOICDCNKJNSS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)S(=O)(=O)C3CC3 |
Computed by PubChem (NCBI)