Products 1428327-90-5
CAS 1428327-90-5 is the registry number for {4-[4-(Ethanesulfonyl)piperazin-1-yl]phenyl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(4-ethylsulfonylpiperazin-1-yl)phenyl]boronic acid (CAS 1428327-90-5) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: [4-(4-ethylsulfonylpiperazin-1-yl)phenyl]boronic acid. InChIKey: OVWBDFPFKVCXJA-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | [4-(4-ethylsulfonylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | OVWBDFPFKVCXJA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCN(CC2)S(=O)(=O)CC)(O)O |
Computed by PubChem (NCBI)