cas: 1612172-62-9 — see every product listed under this CAS number, including other names
1-(cyclopropanesulfonyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98% (CAS 1612172-62-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519940-25G |
| cas | 1612172-62-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 2096.15 Pln | |
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 607.10 Pln | |
| Fluorochem | 10g | 872.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1612172-62-9) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: 1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: CWOOICDCNKJNSS-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | 1-cyclopropylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | CWOOICDCNKJNSS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)S(=O)(=O)C3CC3 |
Computed by PubChem (NCBI)