cas: 886510-29-8 — see every product listed under this CAS number, including other names
1-(Difluoromethyl)-2,4,5-trifluorobenzene (CAS 886510-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032505-1G |
| cas | 886510-29-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1080.89 Pln |
| delivery time | 2-3 weeks |
|---|
1-(difluoromethyl)-2,4,5-trifluorobenzene (CAS 886510-29-8) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1-(difluoromethyl)-2,4,5-trifluorobenzene. InChIKey: QCDSGWYQEVHVOG-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1-(difluoromethyl)-2,4,5-trifluorobenzene |
| InChIKey | QCDSGWYQEVHVOG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(F)F |
Computed by PubChem (NCBI)