cas: 2179072-33-2 — see every product listed under this CAS number, including other names
1-(Fluorosulfonyl)-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate 97% (CAS 2179072-33-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1195989-1g |
| cas | 2179072-33-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 765.31 Pln | |
| Ambeed | 100g | 2840.12 Pln | |
| Ambeed | 500g | 10416.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1195989 |
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate (CAS 2179072-33-2) is a chemical compound with the molecular formula C6H8F4N2O5S2 and a molecular weight of 328.3 g/mol. IUPAC name: 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate. InChIKey: YAZBWGHMIMMBFC-UHFFFAOYSA-M.
| Molecular formula | C6H8F4N2O5S2 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate |
| InChIKey | YAZBWGHMIMMBFC-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1S(=O)(=O)F)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)