cas: 199274-87-8 — see every product listed under this CAS number, including other names
1-(METHOXYMETHYL)-4-NITRO-1H-PYRAZOLE (CAS 199274-87-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F527649-1G |
| cas | 199274-87-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 2361.69 Pln | |
| Fluorochem | 10g | 4470.32 Pln | |
| Fluorochem | 25g | 8005.53 Pln |
| delivery time | 3-4 weeks |
|---|
1-(methoxymethyl)-4-nitropyrazole (CAS 199274-87-8) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 1-(methoxymethyl)-4-nitropyrazole. InChIKey: UURJXYFOASPHQL-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | 1-(methoxymethyl)-4-nitropyrazole |
| InChIKey | UURJXYFOASPHQL-UHFFFAOYSA-N |
| SMILES | COCN1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)