Products 74731-49-0

CAS 74731-49-0 is the registry number for 1-(2-Hydroxyethyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2-hydroxyethyl)triazole-4-carboxylic acid (CAS 74731-49-0) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 1-(2-hydroxyethyl)triazole-4-carboxylic acid. InChIKey: BNFYIPJNVQYQDM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7N3O3
Molecular weight157.13 g/mol
IUPAC name1-(2-hydroxyethyl)triazole-4-carboxylic acid
InChIKeyBNFYIPJNVQYQDM-UHFFFAOYSA-N
SMILESC1=C(N=NN1CCO)C(=O)O

Computed by PubChem (NCBI)