Products 2167370-98-9

CAS 2167370-98-9 is the registry number for 5-Methoxy-1-methyl-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methoxy-1-methyl-1,2,4-triazole-3-carboxylic acid (CAS 2167370-98-9) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 5-methoxy-1-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: ZXEBHGNFGBAZIG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7N3O3
Molecular weight157.13 g/mol
IUPAC name5-methoxy-1-methyl-1,2,4-triazole-3-carboxylic acid
InChIKeyZXEBHGNFGBAZIG-UHFFFAOYSA-N
SMILESCN1C(=NC(=N1)C(=O)O)OC

Computed by PubChem (NCBI)