cas: 221044-05-9 — see every product listed under this CAS number, including other names
1-(PYRIMIDIN-2-YL)-1H-INDOLE, 98% (CAS 221044-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F535681-250MG |
| cas | 221044-05-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 2111.77 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-pyrimidin-2-ylindole (CAS 221044-05-9) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 1-pyrimidin-2-ylindole. InChIKey: CNAQMKUJWYJTRY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-pyrimidin-2-ylindole |
| InChIKey | CNAQMKUJWYJTRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=NC=CC=N3 |
Computed by PubChem (NCBI)