CAS 832-81-5 is the registry number for 3-Phenyl-1,2,3-triazolo(1,5-a)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-phenyltriazolo[1,5-a]pyridine (CAS 832-81-5) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 3-phenyltriazolo[1,5-a]pyridine. InChIKey: CNTOUGGARXCZSF-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-phenyltriazolo[1,5-a]pyridine |
| InChIKey | CNTOUGGARXCZSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CN3N=N2 |
Computed by PubChem (NCBI)