CAS 1998216-02-6 is the registry number for 3-(Naphthalen-1-yl)-1H-1,2,4-triazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-naphthalen-1-yl-1H-1,2,4-triazole (CAS 1998216-02-6) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 5-naphthalen-1-yl-1H-1,2,4-triazole. InChIKey: YKKGFDQJKLAEFR-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 5-naphthalen-1-yl-1H-1,2,4-triazole |
| InChIKey | YKKGFDQJKLAEFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC=NN3 |
Computed by PubChem (NCBI)