cas: 1227268-62-3 — see every product listed under this CAS number, including other names
1-(Phenylsulphonyl)-2-chloro-7-azaindole (CAS 1227268-62-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111J4U-100mg |
| cas | 1227268-62-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 443.60 Pln |
| delivery time | 3 weeks |
|---|
1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine (CAS 1227268-62-3) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine. InChIKey: PBXIRLCEYNSXCD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine |
| InChIKey | PBXIRLCEYNSXCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CC=C3)Cl |
Computed by PubChem (NCBI)