cas: 1227268-62-3 — see every product listed under this CAS number, including other names
2-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 1227268-62-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F054452-100MG |
| cas | 1227268-62-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 732.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine (CAS 1227268-62-3) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine. InChIKey: PBXIRLCEYNSXCD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-chloropyrrolo[2,3-b]pyridine |
| InChIKey | PBXIRLCEYNSXCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CC=C3)Cl |
Computed by PubChem (NCBI)