cas: 39639-98-0 — see every product listed under this CAS number, including other names
1-(Pyridin-2-ylcarbonyl)piperazine, 97% (CAS 39639-98-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233303-500MG |
| cas | 39639-98-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1539.06 Pln | |
| Fluorochem | 1g | 2340.86 Pln | |
| Fluorochem | 5g | 6860.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Piperazin-1-yl(pyridin-2-yl)methanone (CAS 39639-98-0) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: piperazin-1-yl(pyridin-2-yl)methanone. InChIKey: IULDWWUGMGLWOB-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | piperazin-1-yl(pyridin-2-yl)methanone |
| InChIKey | IULDWWUGMGLWOB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)