CAS 886508-53-8 appears in our catalog under these names: 5-(Aminomethyl)-1,3-dimethyl-1,3-dihydro-2h-benzimidazol-2-one hydrochloride, 95%, 5-(Aminomethyl)-1,3-dimethyl-1,3-dihydro-2h-benzimidazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 10g, 1g.
5-(aminomethyl)-1,3-dimethylbenzimidazol-2-one (CAS 886508-53-8) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 5-(aminomethyl)-1,3-dimethylbenzimidazol-2-one. InChIKey: GDVGETHSXBLPHM-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-(aminomethyl)-1,3-dimethylbenzimidazol-2-one |
| InChIKey | GDVGETHSXBLPHM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)CN)N(C1=O)C |
Computed by PubChem (NCBI)