CAS 3352-98-5 is the registry number for 4'-Methylacetophenone semicarbazone, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
[1-(4-methylphenyl)ethylideneamino]urea (CAS 3352-98-5) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: [1-(4-methylphenyl)ethylideneamino]urea. InChIKey: UORDOKZAZGHLGC-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | [1-(4-methylphenyl)ethylideneamino]urea |
| InChIKey | UORDOKZAZGHLGC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=NNC(=O)N)C |
Computed by PubChem (NCBI)