cas: 221044-05-9 — see every product listed under this CAS number, including other names
1-(Pyrimidin-2-yl)-1H-indole 98% (CAS 221044-05-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A815836-100mg |
| cas | 221044-05-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 559.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A815836 |
1-pyrimidin-2-ylindole (CAS 221044-05-9) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 1-pyrimidin-2-ylindole. InChIKey: CNAQMKUJWYJTRY-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-pyrimidin-2-ylindole |
| InChIKey | CNAQMKUJWYJTRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=NC=CC=N3 |
Computed by PubChem (NCBI)