cas: 1788641-20-2 — see every product listed under this CAS number, including other names
1-(Pyrrolidin-3-yl)-4,5,6,7-tetrahydro-1H-1,3-benzodiazole dihydrochloride, 98% (CAS 1788641-20-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1062965-5g |
| cas | 1788641-20-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30875.32 Pln | |
| AmBeed | 10g | 44077.60 Pln | |
| AmBeed | 1g | 10394.86 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-pyrrolidin-3-yl-4,5,6,7-tetrahydrobenzimidazole;dihydrochloride (CAS 1788641-20-2) is a chemical compound with the molecular formula C11H19Cl2N3 and a molecular weight of 264.19 g/mol. IUPAC name: 1-pyrrolidin-3-yl-4,5,6,7-tetrahydrobenzimidazole;dihydrochloride. InChIKey: MUTCRAHYQNMGGZ-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 1-pyrrolidin-3-yl-4,5,6,7-tetrahydrobenzimidazole;dihydrochloride |
| InChIKey | MUTCRAHYQNMGGZ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=CN2C3CCNC3.Cl.Cl |
Computed by PubChem (NCBI)