CAS 125819-00-3 is the registry number for 4-(4-Methylpiperazin-1-yl)aniline dihydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 100g, 25g, 500g.
4-(4-methylpiperazin-1-yl)aniline;dihydrochloride (CAS 125819-00-3) is a chemical compound with the molecular formula C11H19Cl2N3 and a molecular weight of 264.19 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)aniline;dihydrochloride. InChIKey: FKSBOPHQYYZQCN-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)aniline;dihydrochloride |
| InChIKey | FKSBOPHQYYZQCN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)