Products 125819-00-3

CAS 125819-00-3 is the registry number for 4-(4-Methylpiperazin-1-yl)aniline dihydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 100g, 25g, 500g.

Structural formula: {0} (CAS {1})

4-(4-methylpiperazin-1-yl)aniline;dihydrochloride (CAS 125819-00-3) is a chemical compound with the molecular formula C11H19Cl2N3 and a molecular weight of 264.19 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)aniline;dihydrochloride. InChIKey: FKSBOPHQYYZQCN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19Cl2N3
Molecular weight264.19 g/mol
IUPAC name4-(4-methylpiperazin-1-yl)aniline;dihydrochloride
InChIKeyFKSBOPHQYYZQCN-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl

Computed by PubChem (NCBI)