CAS 227751-87-3 is the registry number for 3-(5,6,7,8-Tetrahydro-1,8-naphthyridin-2-yl)propan-1-amine dihydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propan-1-amine;dihydrochloride (CAS 227751-87-3) is a chemical compound with the molecular formula C11H19Cl2N3 and a molecular weight of 264.19 g/mol. IUPAC name: 3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propan-1-amine;dihydrochloride. InChIKey: YKENSXATHYFVOK-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propan-1-amine;dihydrochloride |
| InChIKey | YKENSXATHYFVOK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(NC1)N=C(C=C2)CCCN.Cl.Cl |
Computed by PubChem (NCBI)