cas: 194163-91-2 — see every product listed under this CAS number, including other names
1-(TERT-BUTYL) 2-METHYL (2S,4R)-4-CYANOPYRROLIDINE-1,2-DICARBOXYLATE, 98% (CAS 194163-91-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F536095-250MG |
| cas | 194163-91-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1471.37 Pln | |
| Fluorochem | 1g | 3704.96 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl (2S,4R)-4-cyanopyrrolidine-1,2-dicarboxylate (CAS 194163-91-2) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-cyanopyrrolidine-1,2-dicarboxylate. InChIKey: GHLKJIQVORAVHE-IUCAKERBSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-cyanopyrrolidine-1,2-dicarboxylate |
| InChIKey | GHLKJIQVORAVHE-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)C#N |
Computed by PubChem (NCBI)