CAS 487048-28-2 appears in our catalog under these names: Boc-cis-4-cyano-l-proline methyl ester, 98%, cis–N–Boc–4–cyano–L–proline methyl ester, cis-N-Boc-4-cyano-L-proline methyl ester, 97% , Boc-cis-4-CN-Pro-OMe 98%, (2S,4S)-1-tert-Butyl 2-methyl 4-cyanopyrrolidine-1,2-dicarboxylate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 250mg, 100g, 10g.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate (CAS 487048-28-2) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate. InChIKey: GHLKJIQVORAVHE-BDAKNGLRSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate |
| InChIKey | GHLKJIQVORAVHE-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)C#N |
Computed by PubChem (NCBI)