CAS 148274-67-3 is the registry number for 2-Nitro-4,5-dipropoxyaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-nitro-4,5-dipropoxyaniline (CAS 148274-67-3) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 2-nitro-4,5-dipropoxyaniline. InChIKey: GUNXHZFNPWODAC-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2-nitro-4,5-dipropoxyaniline |
| InChIKey | GUNXHZFNPWODAC-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C(=C1)N)[N+](=O)[O-])OCCC |
Computed by PubChem (NCBI)