cas: 1260665-09-5 — see every product listed under this CAS number, including other names
1-(TERT-BUTYL)-1H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID, 95% (CAS 1260665-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501002-1G |
| cas | 1260665-09-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 653.95 Pln | |
| Fluorochem | 25g | 1294.35 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-tert-butyltriazole-4-carboxylic acid (CAS 1260665-09-5) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 1-tert-butyltriazole-4-carboxylic acid. InChIKey: MNFXHDKCPWMRCJ-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 1-tert-butyltriazole-4-carboxylic acid |
| InChIKey | MNFXHDKCPWMRCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(N=N1)C(=O)O |
Computed by PubChem (NCBI)