CAS 17720-12-6 appears in our catalog under these names: D-Histidine methyl ester, 95%, D-Histidine Methyl Ester, (R)-Methyl 2-amino-3-(1H-imidazol-4-yl)propanoate, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 2,5g.
Methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate (CAS 17720-12-6) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate. InChIKey: BXRMEWOQUXOLDH-ZCFIWIBFSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate |
| InChIKey | BXRMEWOQUXOLDH-ZCFIWIBFSA-N |
| SMILES | COC(=O)[C@@H](CC1=CN=CN1)N |
Computed by PubChem (NCBI)