CAS 1260665-09-5 appears in our catalog under these names: 1-tert-Butyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(tert-butyl)-1H-1,2,3-triazole-4-carboxylic acid, 1-(tert-Butyl)-1H-1,2,3-triazole-4-carboxylic acid 97%, 1-tert-butyl-1H-1,2,3-triazole-4-carboxylic acid, 98%, 98%, 1-(TERT-BUTYL)-1H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1-tert-butyltriazole-4-carboxylic acid (CAS 1260665-09-5) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 1-tert-butyltriazole-4-carboxylic acid. InChIKey: MNFXHDKCPWMRCJ-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 1-tert-butyltriazole-4-carboxylic acid |
| InChIKey | MNFXHDKCPWMRCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(N=N1)C(=O)O |
Computed by PubChem (NCBI)