cas: 903550-26-5 — see every product listed under this CAS number, including other names
1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole-5-boronic acid pinacol ester, 97%, 97% (CAS 903550-26-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143JA-1g |
| cas | 903550-26-5 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 174.80 Pln | |
| Chemat | 100g | 275.60 Pln | |
| Chemat | 1kg | 1355.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 903550-26-5) is a chemical compound with the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. IUPAC name: 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ZZRFDLHBMBHJTI-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O3 |
|---|---|
| Molecular weight | 278.16 g/mol |
| IUPAC name | 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ZZRFDLHBMBHJTI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CCCCO3 |
Computed by PubChem (NCBI)