CAS 948294-96-0 appears in our catalog under these names: ((R)-1-((S)-2-amino-3-phenylpropanamido)-3-methylbutyl)boronic acid, Des-pyrazinecarboxaldehyde Bortezomib. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[(1R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutyl]boronic acid (CAS 948294-96-0) is a chemical compound with the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. IUPAC name: [(1R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutyl]boronic acid. InChIKey: HCSFPFDGDYVJDD-STQMWFEESA-N.
| Molecular formula | C14H23BN2O3 |
|---|---|
| Molecular weight | 278.16 g/mol |
| IUPAC name | [(1R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutyl]boronic acid |
| InChIKey | HCSFPFDGDYVJDD-STQMWFEESA-N |
| SMILES | B([C@H](CC(C)C)NC(=O)[C@H](CC1=CC=CC=C1)N)(O)O |
Computed by PubChem (NCBI)