CAS 903550-26-5 appears in our catalog under these names: (1-(Tetrahydropyran-2-yl)-1H-pyrazol-5-yl)boronic Acid Pinacol Ester, >95% (HPLC), 1–(Tetrahydro–2H–pyran–2–yl)–1H–pyrazole–5–boronic acid pinacol ester, 1-(2-Tetrahydropyranyl)-1H-pyrazole-5-boronic acid pinacol e, 1-(Tetrahydropyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole, >98.0%(GC)(T), 1-(Tetrahydropyran-2-yl)-1H-pyrazole-5-boronic acid pinacol ester 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 100g, 25g, 1g, 5g, 10g.
1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 903550-26-5) is a chemical compound with the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. IUPAC name: 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ZZRFDLHBMBHJTI-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O3 |
|---|---|
| Molecular weight | 278.16 g/mol |
| IUPAC name | 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ZZRFDLHBMBHJTI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C3CCCCO3 |
Computed by PubChem (NCBI)