cas: 2377587-58-9 — see every product listed under this CAS number, including other names
1-(Tetrahydro-2H-pyran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-5-carbaldehyde, 95%, 95% (CAS 2377587-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRVZ-100mg |
| cas | 2377587-58-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 1g | 2517.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde (CAS 2377587-58-9) is a chemical compound with the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. IUPAC name: 1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde. InChIKey: FBGODNQUPAADSI-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O4 |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | 1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde |
| InChIKey | FBGODNQUPAADSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2)C3CCCCO3)C=O |
Computed by PubChem (NCBI)