cas: 1422126-12-2 — see every product listed under this CAS number, including other names
1-[2-(AZETIDIN-1-YL)ETHYL]-4-(TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE, 98% (CAS 1422126-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504522-100MG |
| cas | 1422126-12-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 935.11 Pln | |
| Fluorochem | 1g | 2502.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[2-(azetidin-1-yl)ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1422126-12-2) is a chemical compound with the molecular formula C14H24BN3O2 and a molecular weight of 277.17 g/mol. IUPAC name: 1-[2-(azetidin-1-yl)ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: UPOMLRSTOUFYAC-UHFFFAOYSA-N.
| Molecular formula | C14H24BN3O2 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | 1-[2-(azetidin-1-yl)ethyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | UPOMLRSTOUFYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCN3CCC3 |
Computed by PubChem (NCBI)